C7H12N2O — CID 82418197
6,6-dimethylmorpholine-3-carbonitrile (PubChem CID 82418197) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 6,6-dimethylmorpholine-3-carbonitrile.
| Compound Name | 6,6-dimethylmorpholine-3-carbonitrile |
|---|---|
| PubChem CID | 82418197 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 6,6-dimethylmorpholine-3-carbonitrile |
| SMILES | CC1(C)CNC(C#N)CO1 |
| InChI | InChI=1S/C7H12N2O/c1-7(2)5-9-6(3-8)4-10-7/h6,9H,4-5H2,1-2H3 |
| InChIKey | FMCPIMNTIBAZTG-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |