About furo[3,2-d][1,3]oxazole-6-carbonitrile
furo[3,2-d][1,3]oxazole-6-carbonitrile (PubChem CID 82418672) has the molecular formula C6H2N2O2
and a molecular weight of 134.09 g/mol. Its IUPAC name is furo[3,2-d][1,3]oxazole-6-carbonitrile.
Molecular Properties
| Compound Name | furo[3,2-d][1,3]oxazole-6-carbonitrile |
| PubChem CID | 82418672 |
| Molecular Formula | C6H2N2O2 |
| Molecular Weight | 134.09 g/mol |
| Exact Mass | 134.01 |
| IUPAC Name | furo[3,2-d][1,3]oxazole-6-carbonitrile |
| SMILES | N#Cc1coc2ocnc12 |
| InChI | InChI=1S/C6H2N2O2/c7-1-4-2-9-6-5(4)8-3-10-6/h2-3H |
| InChIKey | LCQDWIGVEHJBCL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 62.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.09 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze furo[3,2-d][1,3]oxazole-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furo[3,2-d][1,3]oxazole-6-carbonitrile?
The IUPAC name of furo[3,2-d][1,3]oxazole-6-carbonitrile (CID 82418672) is furo[3,2-d][1,3]oxazole-6-carbonitrile.
What is the SMILES notation for furo[3,2-d][1,3]oxazole-6-carbonitrile?
The canonical SMILES for furo[3,2-d][1,3]oxazole-6-carbonitrile is N#Cc1coc2ocnc12.
What is the InChIKey of furo[3,2-d][1,3]oxazole-6-carbonitrile?
The InChIKey is LCQDWIGVEHJBCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2N2O2/c7-1-4-2-9-6-5(4)8-3-10-6/h2-3H.
What are the key properties of furo[3,2-d][1,3]oxazole-6-carbonitrile?
furo[3,2-d][1,3]oxazole-6-carbonitrile has a molecular weight of 134.09 g/mol, XLogP of 1.29, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for furo[3,2-d][1,3]oxazole-6-carbonitrile is sourced from PubChem (CID 82418672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).