C13H12N2O3 — CID 82420214
1-(2,6-dimethylphenyl)-4-hydroxy-6-oxopyridazine-3-carbaldehyde (PubChem CID 82420214) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-4-hydroxy-6-oxopyridazine-3-carbaldehyde.
| Compound Name | 1-(2,6-dimethylphenyl)-4-hydroxy-6-oxopyridazine-3-carbaldehyde |
|---|---|
| PubChem CID | 82420214 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-4-hydroxy-6-oxopyridazine-3-carbaldehyde |
| SMILES | Cc1cccc(C)c1-n1nc(C=O)c(O)cc1=O |
| InChI | InChI=1S/C13H12N2O3/c1-8-4-3-5-9(2)13(8)15-12(18)6-11(17)10(7-16)14-15/h3-7,17H,1-2H3 |
| InChIKey | IJFXAYDBXOWNDS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|