C14H12F3NO2 — CID 82420554
5-(hydroxymethyl)-2-methyl-1-[2-(trifluoromethyl)phenyl]pyridin-4-one (PubChem CID 82420554) has the molecular formula C14H12F3NO2 and a molecular weight of 283.25 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-methyl-1-[2-(trifluoromethyl)phenyl]pyridin-4-one.
| Compound Name | 5-(hydroxymethyl)-2-methyl-1-[2-(trifluoromethyl)phenyl]pyridin-4-one |
|---|---|
| PubChem CID | 82420554 |
| Molecular Formula | C14H12F3NO2 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 5-(hydroxymethyl)-2-methyl-1-[2-(trifluoromethyl)phenyl]pyridin-4-one |
| SMILES | Cc1cc(=O)c(CO)cn1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H12F3NO2/c1-9-6-13(20)10(8-19)7-18(9)12-5-3-2-4-11(12)14(15,16)17/h2-7,19H,8H2,1H3 |
| InChIKey | DKZOMEIHIGKRLJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |