C13H10F3NO2 — CID 82420858
5-(hydroxymethyl)-2-methyl-1-(2,3,4-trifluorophenyl)pyridin-4-one (PubChem CID 82420858) has the molecular formula C13H10F3NO2 and a molecular weight of 269.22 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-methyl-1-(2,3,4-trifluorophenyl)pyridin-4-one.
| Compound Name | 5-(hydroxymethyl)-2-methyl-1-(2,3,4-trifluorophenyl)pyridin-4-one |
|---|---|
| PubChem CID | 82420858 |
| Molecular Formula | C13H10F3NO2 |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 5-(hydroxymethyl)-2-methyl-1-(2,3,4-trifluorophenyl)pyridin-4-one |
| SMILES | Cc1cc(=O)c(CO)cn1-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H10F3NO2/c1-7-4-11(19)8(6-18)5-17(7)10-3-2-9(14)12(15)13(10)16/h2-5,18H,6H2,1H3 |
| InChIKey | JOAYQFWUMLBPML-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|