About 6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridine-3-carbonitrile
6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridine-3-carbonitrile (PubChem CID 82420859) has the molecular formula C13H7F3N2O
and a molecular weight of 264.21 g/mol. Its IUPAC name is 6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridine-3-carbonitrile |
| PubChem CID | 82420859 |
| Molecular Formula | C13H7F3N2O |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridine-3-carbonitrile |
| SMILES | Cc1cc(=O)c(C#N)cn1-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H7F3N2O/c1-7-4-11(19)8(5-17)6-18(7)10-3-2-9(14)12(15)13(10)16/h2-4,6H,1H3 |
| InChIKey | XFZBWNPZUIJSCD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridine-3-carbonitrile?
The IUPAC name of 6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridine-3-carbonitrile (CID 82420859) is 6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridine-3-carbonitrile.
What is the SMILES notation for 6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridine-3-carbonitrile?
The canonical SMILES for 6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridine-3-carbonitrile is Cc1cc(=O)c(C#N)cn1-c1ccc(F)c(F)c1F.
What is the InChIKey of 6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridine-3-carbonitrile?
The InChIKey is XFZBWNPZUIJSCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F3N2O/c1-7-4-11(19)8(5-17)6-18(7)10-3-2-9(14)12(15)13(10)16/h2-4,6H,1H3.
What are the key properties of 6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridine-3-carbonitrile?
6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridine-3-carbonitrile has a molecular weight of 264.21 g/mol, XLogP of 2.43, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridine-3-carbonitrile is sourced from PubChem (CID 82420859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).