C13H7F3N2O — CID 82420859
6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridine-3-carbonitrile (PubChem CID 82420859) has the molecular formula C13H7F3N2O and a molecular weight of 264.21 g/mol. Its IUPAC name is 6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridine-3-carbonitrile.
| Compound Name | 6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 82420859 |
| Molecular Formula | C13H7F3N2O |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridine-3-carbonitrile |
| SMILES | Cc1cc(=O)c(C#N)cn1-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H7F3N2O/c1-7-4-11(19)8(5-17)6-18(7)10-3-2-9(14)12(15)13(10)16/h2-4,6H,1H3 |
| InChIKey | XFZBWNPZUIJSCD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|