C12H6F3N3O — CID 82420881
6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridazine-3-carbonitrile (PubChem CID 82420881) has the molecular formula C12H6F3N3O and a molecular weight of 265.19 g/mol. Its IUPAC name is 6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridazine-3-carbonitrile.
| Compound Name | 6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 82420881 |
| Molecular Formula | C12H6F3N3O |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 6-methyl-4-oxo-1-(2,3,4-trifluorophenyl)pyridazine-3-carbonitrile |
| SMILES | Cc1cc(=O)c(C#N)nn1-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H6F3N3O/c1-6-4-10(19)8(5-16)17-18(6)9-3-2-7(13)11(14)12(9)15/h2-4H,1H3 |
| InChIKey | XJGXRSOKIGCNAR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|