C13H12F3N3O — CID 82420897
3-(1-aminoethyl)-6-methyl-1-(2,3,4-trifluorophenyl)pyridazin-4-one (PubChem CID 82420897) has the molecular formula C13H12F3N3O and a molecular weight of 283.25 g/mol. Its IUPAC name is 3-(1-aminoethyl)-6-methyl-1-(2,3,4-trifluorophenyl)pyridazin-4-one.
| Compound Name | 3-(1-aminoethyl)-6-methyl-1-(2,3,4-trifluorophenyl)pyridazin-4-one |
|---|---|
| PubChem CID | 82420897 |
| Molecular Formula | C13H12F3N3O |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 3-(1-aminoethyl)-6-methyl-1-(2,3,4-trifluorophenyl)pyridazin-4-one |
| SMILES | Cc1cc(=O)c(C(C)N)nn1-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H12F3N3O/c1-6-5-10(20)13(7(2)17)18-19(6)9-4-3-8(14)11(15)12(9)16/h3-5,7H,17H2,1-2H3 |
| InChIKey | LNMNALFWNLDZJN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|