C10H16N4OS — CID 82425083
2-(2-morpholin-4-ylethyl)-1,3-thiazole-5-carboximidamide (PubChem CID 82425083) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is 2-(2-morpholin-4-ylethyl)-1,3-thiazole-5-carboximidamide.
| Compound Name | 2-(2-morpholin-4-ylethyl)-1,3-thiazole-5-carboximidamide |
|---|---|
| PubChem CID | 82425083 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-(2-morpholin-4-ylethyl)-1,3-thiazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1cnc(CCN2CCOCC2)s1 |
| InChI | InChI=1S/C10H16N4OS/c11-10(12)8-7-13-9(16-8)1-2-14-3-5-15-6-4-14/h7H,1-6H2,(H3,11,12) |
| InChIKey | CNCRXRZKCWXHEF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|