C12H8F2N4S2 — CID 82425941
5-[2-(2,6-difluorophenyl)-4-methyl-1,3-thiazol-5-yl]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 82425941) has the molecular formula C12H8F2N4S2 and a molecular weight of 310.35 g/mol. Its IUPAC name is 5-[2-(2,6-difluorophenyl)-4-methyl-1,3-thiazol-5-yl]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[2-(2,6-difluorophenyl)-4-methyl-1,3-thiazol-5-yl]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 82425941 |
| Molecular Formula | C12H8F2N4S2 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 5-[2-(2,6-difluorophenyl)-4-methyl-1,3-thiazol-5-yl]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | Cc1nc(-c2c(F)cccc2F)sc1-c1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C12H8F2N4S2/c1-5-9(10-16-12(19)18-17-10)20-11(15-5)8-6(13)3-2-4-7(8)14/h2-4H,1H3,(H2,16,17,18,19) |
| InChIKey | DXZIXOGMXQUOOC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|