C11H16N2S — CID 82429659
4-ethyl-2-pentan-3-yl-1,3-thiazole-5-carbonitrile (PubChem CID 82429659) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is 4-ethyl-2-pentan-3-yl-1,3-thiazole-5-carbonitrile.
| Compound Name | 4-ethyl-2-pentan-3-yl-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 82429659 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 4-ethyl-2-pentan-3-yl-1,3-thiazole-5-carbonitrile |
| SMILES | CCc1nc(C(CC)CC)sc1C#N |
| InChI | InChI=1S/C11H16N2S/c1-4-8(5-2)11-13-9(6-3)10(7-12)14-11/h8H,4-6H2,1-3H3 |
| InChIKey | GTFNAWOUOGVBNY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |