C9H12N2S — CID 82431269
2-ethyl-4-propyl-1,3-thiazole-5-carbonitrile (PubChem CID 82431269) has the molecular formula C9H12N2S and a molecular weight of 180.28 g/mol. Its IUPAC name is 2-ethyl-4-propyl-1,3-thiazole-5-carbonitrile.
| Compound Name | 2-ethyl-4-propyl-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 82431269 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 2-ethyl-4-propyl-1,3-thiazole-5-carbonitrile |
| SMILES | CCCc1nc(CC)sc1C#N |
| InChI | InChI=1S/C9H12N2S/c1-3-5-7-8(6-10)12-9(4-2)11-7/h3-5H2,1-2H3 |
| InChIKey | ZWQNBQRYVFLDJK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |