C10H14N2OS2 — CID 82440714
4-(methoxymethyl)-2-(propylsulfanylmethyl)-1,3-thiazole-5-carbonitrile (PubChem CID 82440714) has the molecular formula C10H14N2OS2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 4-(methoxymethyl)-2-(propylsulfanylmethyl)-1,3-thiazole-5-carbonitrile.
| Compound Name | 4-(methoxymethyl)-2-(propylsulfanylmethyl)-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 82440714 |
| Molecular Formula | C10H14N2OS2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 4-(methoxymethyl)-2-(propylsulfanylmethyl)-1,3-thiazole-5-carbonitrile |
| SMILES | CCCSCc1nc(COC)c(C#N)s1 |
| InChI | InChI=1S/C10H14N2OS2/c1-3-4-14-7-10-12-8(6-13-2)9(5-11)15-10/h3-4,6-7H2,1-2H3 |
| InChIKey | GHLCULIWNYBKQI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|