C10H14N4S2 — CID 82438256
5-(4-tert-butyl-2-methyl-1,3-thiazol-5-yl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 82438256) has the molecular formula C10H14N4S2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 5-(4-tert-butyl-2-methyl-1,3-thiazol-5-yl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(4-tert-butyl-2-methyl-1,3-thiazol-5-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 82438256 |
| Molecular Formula | C10H14N4S2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 5-(4-tert-butyl-2-methyl-1,3-thiazol-5-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | Cc1nc(C(C)(C)C)c(-c2nc(=S)[nH][nH]2)s1 |
| InChI | InChI=1S/C10H14N4S2/c1-5-11-7(10(2,3)4)6(16-5)8-12-9(15)14-13-8/h1-4H3,(H2,12,13,14,15) |
| InChIKey | DOBSQFVMLJWVJI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|