C15H23N3S2 — CID 82438277
N-butyl-4-(4-tert-butyl-2-methyl-1,3-thiazol-5-yl)-1,3-thiazol-2-amine (PubChem CID 82438277) has the molecular formula C15H23N3S2 and a molecular weight of 309.50 g/mol. Its IUPAC name is N-butyl-4-(4-tert-butyl-2-methyl-1,3-thiazol-5-yl)-1,3-thiazol-2-amine.
| Compound Name | N-butyl-4-(4-tert-butyl-2-methyl-1,3-thiazol-5-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82438277 |
| Molecular Formula | C15H23N3S2 |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-butyl-4-(4-tert-butyl-2-methyl-1,3-thiazol-5-yl)-1,3-thiazol-2-amine |
| SMILES | CCCCNc1nc(-c2sc(C)nc2C(C)(C)C)cs1 |
| InChI | InChI=1S/C15H23N3S2/c1-6-7-8-16-14-18-11(9-19-14)12-13(15(3,4)5)17-10(2)20-12/h9H,6-8H2,1-5H3,(H,16,18) |
| InChIKey | KBMUDOGQQDYVFQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|