C14H23NOS — CID 82439111
1-(4-tert-butyl-2-pentan-3-yl-1,3-thiazol-5-yl)ethanone (PubChem CID 82439111) has the molecular formula C14H23NOS and a molecular weight of 253.41 g/mol. Its IUPAC name is 1-(4-tert-butyl-2-pentan-3-yl-1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-(4-tert-butyl-2-pentan-3-yl-1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 82439111 |
| Molecular Formula | C14H23NOS |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 1-(4-tert-butyl-2-pentan-3-yl-1,3-thiazol-5-yl)ethanone |
| SMILES | CCC(CC)c1nc(C(C)(C)C)c(C(C)=O)s1 |
| InChI | InChI=1S/C14H23NOS/c1-7-10(8-2)13-15-12(14(4,5)6)11(17-13)9(3)16/h10H,7-8H2,1-6H3 |
| InChIKey | AWLHPOTUIWIGEU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |