C10H17N3OS — CID 82426688
4-methyl-2-pentan-3-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 82426688) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 4-methyl-2-pentan-3-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | 4-methyl-2-pentan-3-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 82426688 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-methyl-2-pentan-3-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | CCC(CC)c1nc(C)c(C(=O)NN)s1 |
| InChI | InChI=1S/C10H17N3OS/c1-4-7(5-2)10-12-6(3)8(15-10)9(14)13-11/h7H,4-5,11H2,1-3H3,(H,13,14) |
| InChIKey | QAJZCNBKIQZBGG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|