C16H21ClN2 — CID 82448981
N-[(2-tert-butyl-8-chloroquinolin-4-yl)methyl]ethanamine (PubChem CID 82448981) has the molecular formula C16H21ClN2 and a molecular weight of 276.81 g/mol. Its IUPAC name is N-[(2-tert-butyl-8-chloroquinolin-4-yl)methyl]ethanamine.
| Compound Name | N-[(2-tert-butyl-8-chloroquinolin-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 82448981 |
| Molecular Formula | C16H21ClN2 |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N-[(2-tert-butyl-8-chloroquinolin-4-yl)methyl]ethanamine |
| SMILES | CCNCc1cc(C(C)(C)C)nc2c(Cl)cccc12 |
| InChI | InChI=1S/C16H21ClN2/c1-5-18-10-11-9-14(16(2,3)4)19-15-12(11)7-6-8-13(15)17/h6-9,18H,5,10H2,1-4H3 |
| InChIKey | ZZCNJRBNWZXXHX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |