C17H18N4S — CID 82451003
5-(6,7-dimethyl-1,2,3,4-tetrahydroacridin-9-yl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 82451003) has the molecular formula C17H18N4S and a molecular weight of 310.43 g/mol. Its IUPAC name is 5-(6,7-dimethyl-1,2,3,4-tetrahydroacridin-9-yl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(6,7-dimethyl-1,2,3,4-tetrahydroacridin-9-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 82451003 |
| Molecular Formula | C17H18N4S |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 5-(6,7-dimethyl-1,2,3,4-tetrahydroacridin-9-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | Cc1cc2nc3c(c(-c4nc(=S)[nH][nH]4)c2cc1C)CCCC3 |
| InChI | InChI=1S/C17H18N4S/c1-9-7-12-14(8-10(9)2)18-13-6-4-3-5-11(13)15(12)16-19-17(22)21-20-16/h7-8H,3-6H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | TUDISYSXZKFIKO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|