C14H27N5O2 — CID 82455290
4-N-[3-(diethylamino)propyl]-6-(2-methoxyethoxy)pyrimidine-4,5-diamine (PubChem CID 82455290) has the molecular formula C14H27N5O2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 4-N-[3-(diethylamino)propyl]-6-(2-methoxyethoxy)pyrimidine-4,5-diamine.
| Compound Name | 4-N-[3-(diethylamino)propyl]-6-(2-methoxyethoxy)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 82455290 |
| Molecular Formula | C14H27N5O2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 4-N-[3-(diethylamino)propyl]-6-(2-methoxyethoxy)pyrimidine-4,5-diamine |
| SMILES | CCN(CC)CCCNc1ncnc(OCCOC)c1N |
| InChI | InChI=1S/C14H27N5O2/c1-4-19(5-2)8-6-7-16-13-12(15)14(18-11-17-13)21-10-9-20-3/h11H,4-10,15H2,1-3H3,(H,16,17,18) |
| InChIKey | LFKCSSYPPCUPHB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|