C14H26N4S — CID 82457222
6-[4-(diethylamino)butylamino]-2-ethyl-1H-pyrimidine-4-thione (PubChem CID 82457222) has the molecular formula C14H26N4S and a molecular weight of 282.46 g/mol. Its IUPAC name is 6-[4-(diethylamino)butylamino]-2-ethyl-1H-pyrimidine-4-thione.
| Compound Name | 6-[4-(diethylamino)butylamino]-2-ethyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457222 |
| Molecular Formula | C14H26N4S |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 6-[4-(diethylamino)butylamino]-2-ethyl-1H-pyrimidine-4-thione |
| SMILES | CCc1nc(=S)cc(NCCCCN(CC)CC)[nH]1 |
| InChI | InChI=1S/C14H26N4S/c1-4-12-16-13(11-14(19)17-12)15-9-7-8-10-18(5-2)6-3/h11H,4-10H2,1-3H3,(H2,15,16,17,19) |
| InChIKey | HYHRSUWMYQMOTD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|