C16H29N3S — CID 82457644
2-(2-methylpropyl)-6-(2,4,4-trimethylpentan-2-ylamino)-1H-pyrimidine-4-thione (PubChem CID 82457644) has the molecular formula C16H29N3S and a molecular weight of 295.50 g/mol. Its IUPAC name is 2-(2-methylpropyl)-6-(2,4,4-trimethylpentan-2-ylamino)-1H-pyrimidine-4-thione.
| Compound Name | 2-(2-methylpropyl)-6-(2,4,4-trimethylpentan-2-ylamino)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457644 |
| Molecular Formula | C16H29N3S |
| Molecular Weight | 295.50 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 2-(2-methylpropyl)-6-(2,4,4-trimethylpentan-2-ylamino)-1H-pyrimidine-4-thione |
| SMILES | CC(C)Cc1nc(=S)cc(NC(C)(C)CC(C)(C)C)[nH]1 |
| InChI | InChI=1S/C16H29N3S/c1-11(2)8-12-17-13(9-14(20)18-12)19-16(6,7)10-15(3,4)5/h9,11H,8,10H2,1-7H3,(H2,17,18,19,20) |
| InChIKey | PVGXATLFDPDCOO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|