C12H17ClN4O2 — CID 82463284
N-[3-[[6-chloro-2-(oxolan-2-yl)pyrimidin-4-yl]amino]propyl]formamide (PubChem CID 82463284) has the molecular formula C12H17ClN4O2 and a molecular weight of 284.75 g/mol. Its IUPAC name is N-[3-[[6-chloro-2-(oxolan-2-yl)pyrimidin-4-yl]amino]propyl]formamide.
| Compound Name | N-[3-[[6-chloro-2-(oxolan-2-yl)pyrimidin-4-yl]amino]propyl]formamide |
|---|---|
| PubChem CID | 82463284 |
| Molecular Formula | C12H17ClN4O2 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-[3-[[6-chloro-2-(oxolan-2-yl)pyrimidin-4-yl]amino]propyl]formamide |
| SMILES | O=CNCCCNc1cc(Cl)nc(C2CCCO2)n1 |
| InChI | InChI=1S/C12H17ClN4O2/c13-10-7-11(15-5-2-4-14-8-18)17-12(16-10)9-3-1-6-19-9/h7-9H,1-6H2,(H,14,18)(H,15,16,17) |
| InChIKey | BFAODCJKECCTET-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|