C10H13BrN4O2 — CID 82465330
8-(bromomethyl)-3-butan-2-yl-7H-purine-2,6-dione (PubChem CID 82465330) has the molecular formula C10H13BrN4O2 and a molecular weight of 301.14 g/mol. Its IUPAC name is 8-(bromomethyl)-3-butan-2-yl-7H-purine-2,6-dione.
| Compound Name | 8-(bromomethyl)-3-butan-2-yl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 82465330 |
| Molecular Formula | C10H13BrN4O2 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 8-(bromomethyl)-3-butan-2-yl-7H-purine-2,6-dione |
| SMILES | CCC(C)n1c(=O)[nH]c(=O)c2[nH]c(CBr)nc21 |
| InChI | InChI=1S/C10H13BrN4O2/c1-3-5(2)15-8-7(9(16)14-10(15)17)12-6(4-11)13-8/h5H,3-4H2,1-2H3,(H,12,13)(H,14,16,17) |
| InChIKey | CFNFJTVCUYDMAA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|