C14H15N3 — CID 82473451
2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)aniline (PubChem CID 82473451) has the molecular formula C14H15N3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)aniline.
| Compound Name | 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 82473451 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)aniline |
| SMILES | Nc1ccccc1Cc1ncc2c(n1)CCC2 |
| InChI | InChI=1S/C14H15N3/c15-12-6-2-1-4-10(12)8-14-16-9-11-5-3-7-13(11)17-14/h1-2,4,6,9H,3,5,7-8,15H2 |
| InChIKey | LDXROUALAUSLKH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|