C17H21N3 — CID 82487373
2-methyl-5-[2-(5,6,7,8-tetrahydroquinazolin-2-yl)ethyl]aniline (PubChem CID 82487373) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 2-methyl-5-[2-(5,6,7,8-tetrahydroquinazolin-2-yl)ethyl]aniline.
| Compound Name | 2-methyl-5-[2-(5,6,7,8-tetrahydroquinazolin-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 82487373 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 2-methyl-5-[2-(5,6,7,8-tetrahydroquinazolin-2-yl)ethyl]aniline |
| SMILES | Cc1ccc(CCc2ncc3c(n2)CCCC3)cc1N |
| InChI | InChI=1S/C17H21N3/c1-12-6-7-13(10-15(12)18)8-9-17-19-11-14-4-2-3-5-16(14)20-17/h6-7,10-11H,2-5,8-9,18H2,1H3 |
| InChIKey | VHOYAFDDPPAHDO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|