C12H11N3 — CID 157029881
2-pyridin-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidine (PubChem CID 157029881) has the molecular formula C12H11N3 and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-pyridin-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidine.
| Compound Name | 2-pyridin-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
|---|---|
| PubChem CID | 157029881 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2-pyridin-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
| SMILES | c1ccc(-c2ncc3c(n2)CCC3)nc1 |
| InChI | InChI=1S/C12H11N3/c1-2-7-13-11(5-1)12-14-8-9-4-3-6-10(9)15-12/h1-2,5,7-8H,3-4,6H2 |
| InChIKey | ORXJPWUSXUYZBS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |