C17H22N2Si — CID 10493201
trimethyl-(2-pyridin-2-yl-5,6,7,8-tetrahydroquinolin-3-yl)silane (PubChem CID 10493201) has the molecular formula C17H22N2Si and a molecular weight of 282.46 g/mol. Its IUPAC name is trimethyl-(2-pyridin-2-yl-5,6,7,8-tetrahydroquinolin-3-yl)silane.
| Compound Name | trimethyl-(2-pyridin-2-yl-5,6,7,8-tetrahydroquinolin-3-yl)silane |
|---|---|
| PubChem CID | 10493201 |
| Molecular Formula | C17H22N2Si |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | trimethyl-(2-pyridin-2-yl-5,6,7,8-tetrahydroquinolin-3-yl)silane |
| SMILES | C[Si](C)(C)c1cc2c(nc1-c1ccccn1)CCCC2 |
| InChI | InChI=1S/C17H22N2Si/c1-20(2,3)16-12-13-8-4-5-9-14(13)19-17(16)15-10-6-7-11-18-15/h6-7,10-12H,4-5,8-9H2,1-3H3 |
| InChIKey | ZTOJUQHJZGHJFW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|