C13H11BrN2 — CID 82489137
2-(3-bromophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidine (PubChem CID 82489137) has the molecular formula C13H11BrN2 and a molecular weight of 275.15 g/mol. Its IUPAC name is 2-(3-bromophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidine.
| Compound Name | 2-(3-bromophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
|---|---|
| PubChem CID | 82489137 |
| Molecular Formula | C13H11BrN2 |
| Molecular Weight | 275.15 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 2-(3-bromophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
| SMILES | Brc1cccc(-c2ncc3c(n2)CCC3)c1 |
| InChI | InChI=1S/C13H11BrN2/c14-11-5-1-3-9(7-11)13-15-8-10-4-2-6-12(10)16-13/h1,3,5,7-8H,2,4,6H2 |
| InChIKey | PZMRVSWDYWWKJR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.15 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |