C15H24N4 — CID 82484819
4-[4-[2-(cyclohexen-1-yl)ethyl]-1,2,4-triazol-3-yl]piperidine (PubChem CID 82484819) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is 4-[4-[2-(cyclohexen-1-yl)ethyl]-1,2,4-triazol-3-yl]piperidine.
| Compound Name | 4-[4-[2-(cyclohexen-1-yl)ethyl]-1,2,4-triazol-3-yl]piperidine |
|---|---|
| PubChem CID | 82484819 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 4-[4-[2-(cyclohexen-1-yl)ethyl]-1,2,4-triazol-3-yl]piperidine |
| SMILES | C1=C(CCn2cnnc2C2CCNCC2)CCCC1 |
| InChI | InChI=1S/C15H24N4/c1-2-4-13(5-3-1)8-11-19-12-17-18-15(19)14-6-9-16-10-7-14/h4,12,14,16H,1-3,5-11H2 |
| InChIKey | RADDHGPQWDMLBH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|