C14H16ClN3 — CID 82485386
2-chloro-5-[2-(2,6-dimethylpyrimidin-4-yl)ethyl]aniline (PubChem CID 82485386) has the molecular formula C14H16ClN3 and a molecular weight of 261.76 g/mol. Its IUPAC name is 2-chloro-5-[2-(2,6-dimethylpyrimidin-4-yl)ethyl]aniline.
| Compound Name | 2-chloro-5-[2-(2,6-dimethylpyrimidin-4-yl)ethyl]aniline |
|---|---|
| PubChem CID | 82485386 |
| Molecular Formula | C14H16ClN3 |
| Molecular Weight | 261.76 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-chloro-5-[2-(2,6-dimethylpyrimidin-4-yl)ethyl]aniline |
| SMILES | Cc1cc(CCc2ccc(Cl)c(N)c2)nc(C)n1 |
| InChI | InChI=1S/C14H16ClN3/c1-9-7-12(18-10(2)17-9)5-3-11-4-6-13(15)14(16)8-11/h4,6-8H,3,5,16H2,1-2H3 |
| InChIKey | KNYCBLKXPFFKMJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.76 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|