C11H11ClN2S — CID 82477026
2-chloro-5-[2-(1,3-thiazol-2-yl)ethyl]aniline (PubChem CID 82477026) has the molecular formula C11H11ClN2S and a molecular weight of 238.74 g/mol. Its IUPAC name is 2-chloro-5-[2-(1,3-thiazol-2-yl)ethyl]aniline.
| Compound Name | 2-chloro-5-[2-(1,3-thiazol-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 82477026 |
| Molecular Formula | C11H11ClN2S |
| Molecular Weight | 238.74 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 2-chloro-5-[2-(1,3-thiazol-2-yl)ethyl]aniline |
| SMILES | Nc1cc(CCc2nccs2)ccc1Cl |
| InChI | InChI=1S/C11H11ClN2S/c12-9-3-1-8(7-10(9)13)2-4-11-14-5-6-15-11/h1,3,5-7H,2,4,13H2 |
| InChIKey | CRFVNQUMBJPKRE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.74 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|