C12H7F2NO4 — CID 82487230
2-[3-(3,4-difluorophenyl)-2,5-dioxopyrrol-1-yl]acetic acid (PubChem CID 82487230) has the molecular formula C12H7F2NO4 and a molecular weight of 267.19 g/mol. Its IUPAC name is 2-[3-(3,4-difluorophenyl)-2,5-dioxopyrrol-1-yl]acetic acid.
| Compound Name | 2-[3-(3,4-difluorophenyl)-2,5-dioxopyrrol-1-yl]acetic acid |
|---|---|
| PubChem CID | 82487230 |
| Molecular Formula | C12H7F2NO4 |
| Molecular Weight | 267.19 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 2-[3-(3,4-difluorophenyl)-2,5-dioxopyrrol-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C=C(c2ccc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C12H7F2NO4/c13-8-2-1-6(3-9(8)14)7-4-10(16)15(12(7)19)5-11(17)18/h1-4H,5H2,(H,17,18) |
| InChIKey | CGTSSHNOUWVUQE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|