C11H10BrCl2NO — CID 82490299
1-(8-bromo-6-chloro-3,4-dihydro-2H-quinolin-1-yl)-2-chloroethanone (PubChem CID 82490299) has the molecular formula C11H10BrCl2NO and a molecular weight of 323.02 g/mol. Its IUPAC name is 1-(8-bromo-6-chloro-3,4-dihydro-2H-quinolin-1-yl)-2-chloroethanone.
| Compound Name | 1-(8-bromo-6-chloro-3,4-dihydro-2H-quinolin-1-yl)-2-chloroethanone |
|---|---|
| PubChem CID | 82490299 |
| Molecular Formula | C11H10BrCl2NO |
| Molecular Weight | 323.02 g/mol |
| Exact Mass | 320.93 |
| IUPAC Name | 1-(8-bromo-6-chloro-3,4-dihydro-2H-quinolin-1-yl)-2-chloroethanone |
| SMILES | O=C(CCl)N1CCCc2cc(Cl)cc(Br)c21 |
| InChI | InChI=1S/C11H10BrCl2NO/c12-9-5-8(14)4-7-2-1-3-15(11(7)9)10(16)6-13/h4-5H,1-3,6H2 |
| InChIKey | XLADSZCEOQAVGH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.02 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|