2-(7-chloro-1,2-dimethylindol-3-yl)-2-oxoacetic acid

C12H10ClNO3 — CID 82499374

IUPAC2-(7-chloro-1,2-dimethylindol-3-yl)-2-oxoacetic acid
SMILESCc1c(C(=O)C(=O)O)c2cccc(Cl)c2n1C
InChIInChI=1S/C12H10ClNO3/c1-6-9(11(15)12(16)17)7-4-3-5-8(13)10(7)14(6)2/h3-5H,1-2H3,(H,16,17)
InChIKeyYDNMQOCQFVYRON-UHFFFAOYSA-N
MW251.67 g/mol
LogP2.41
Rot. Bonds2

About 2-(7-chloro-1,2-dimethylindol-3-yl)-2-oxoacetic acid

2-(7-chloro-1,2-dimethylindol-3-yl)-2-oxoacetic acid (PubChem CID 82499374) has the molecular formula C12H10ClNO3 and a molecular weight of 251.67 g/mol. Its IUPAC name is 2-(7-chloro-1,2-dimethylindol-3-yl)-2-oxoacetic acid.

Molecular Properties

Compound Name2-(7-chloro-1,2-dimethylindol-3-yl)-2-oxoacetic acid
PubChem CID82499374
Molecular FormulaC12H10ClNO3
Molecular Weight251.67 g/mol
Exact Mass251.03
IUPAC Name2-(7-chloro-1,2-dimethylindol-3-yl)-2-oxoacetic acid
SMILESCc1c(C(=O)C(=O)O)c2cccc(Cl)c2n1C
InChIInChI=1S/C12H10ClNO3/c1-6-9(11(15)12(16)17)7-4-3-5-8(13)10(7)14(6)2/h3-5H,1-2H3,(H,16,17)
InChIKeyYDNMQOCQFVYRON-UHFFFAOYSA-N
XLogP2.41
TPSA59.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.67
LogP ≤ 52.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2-(7-chloro-1,2-dimethylindol-3-yl)-2-oxoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(7-chloro-1,2-dimethylindol-3-yl)-2-oxoacetic acid?
The IUPAC name of 2-(7-chloro-1,2-dimethylindol-3-yl)-2-oxoacetic acid (CID 82499374) is 2-(7-chloro-1,2-dimethylindol-3-yl)-2-oxoacetic acid.
What is the SMILES notation for 2-(7-chloro-1,2-dimethylindol-3-yl)-2-oxoacetic acid?
The canonical SMILES for 2-(7-chloro-1,2-dimethylindol-3-yl)-2-oxoacetic acid is Cc1c(C(=O)C(=O)O)c2cccc(Cl)c2n1C.
What is the InChIKey of 2-(7-chloro-1,2-dimethylindol-3-yl)-2-oxoacetic acid?
The InChIKey is YDNMQOCQFVYRON-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClNO3/c1-6-9(11(15)12(16)17)7-4-3-5-8(13)10(7)14(6)2/h3-5H,1-2H3,(H,16,17).
What are the key properties of 2-(7-chloro-1,2-dimethylindol-3-yl)-2-oxoacetic acid?
2-(7-chloro-1,2-dimethylindol-3-yl)-2-oxoacetic acid has a molecular weight of 251.67 g/mol, XLogP of 2.41, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-chloro-1,2-dimethylindol-3-yl)-2-oxoacetic acid is sourced from PubChem (CID 82499374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).