C13H10ClFN2O — CID 825003
2-(2-chloro-6-fluorophenyl)-N-pyridin-2-ylacetamide (PubChem CID 825003) has the molecular formula C13H10ClFN2O and a molecular weight of 264.69 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-pyridin-2-ylacetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 825003 |
| Molecular Formula | C13H10ClFN2O |
| Molecular Weight | 264.69 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-pyridin-2-ylacetamide |
| SMILES | O=C(Cc1c(F)cccc1Cl)Nc1ccccn1 |
| InChI | InChI=1S/C13H10ClFN2O/c14-10-4-3-5-11(15)9(10)8-13(18)17-12-6-1-2-7-16-12/h1-7H,8H2,(H,16,17,18) |
| InChIKey | GQADUFZVZPUJGA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.69 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |