C13H15N3O3 — CID 82500785
7-piperazin-1-yl-5,7-dihydro-[1,3]dioxolo[4,5-f]indol-6-one (PubChem CID 82500785) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 7-piperazin-1-yl-5,7-dihydro-[1,3]dioxolo[4,5-f]indol-6-one.
| Compound Name | 7-piperazin-1-yl-5,7-dihydro-[1,3]dioxolo[4,5-f]indol-6-one |
|---|---|
| PubChem CID | 82500785 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 7-piperazin-1-yl-5,7-dihydro-[1,3]dioxolo[4,5-f]indol-6-one |
| SMILES | O=C1Nc2cc3c(cc2C1N1CCNCC1)OCO3 |
| InChI | InChI=1S/C13H15N3O3/c17-13-12(16-3-1-14-2-4-16)8-5-10-11(19-7-18-10)6-9(8)15-13/h5-6,12,14H,1-4,7H2,(H,15,17) |
| InChIKey | NSLDKYQLFHREMS-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |