C9H8N2O3 — CID 82491055
7-amino-5,7-dihydro-[1,3]dioxolo[4,5-f]indol-6-one (PubChem CID 82491055) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is 7-amino-5,7-dihydro-[1,3]dioxolo[4,5-f]indol-6-one.
| Compound Name | 7-amino-5,7-dihydro-[1,3]dioxolo[4,5-f]indol-6-one |
|---|---|
| PubChem CID | 82491055 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 7-amino-5,7-dihydro-[1,3]dioxolo[4,5-f]indol-6-one |
| SMILES | NC1C(=O)Nc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C9H8N2O3/c10-8-4-1-6-7(14-3-13-6)2-5(4)11-9(8)12/h1-2,8H,3,10H2,(H,11,12) |
| InChIKey | KQOUXLYVLOAHDF-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |