C11H18FN3 — CID 82508306
2-(aminomethyl)-5-fluoro-4-N-methyl-4-N-propan-2-ylbenzene-1,4-diamine (PubChem CID 82508306) has the molecular formula C11H18FN3 and a molecular weight of 211.28 g/mol. Its IUPAC name is 2-(aminomethyl)-5-fluoro-4-N-methyl-4-N-propan-2-ylbenzene-1,4-diamine.
| Compound Name | 2-(aminomethyl)-5-fluoro-4-N-methyl-4-N-propan-2-ylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 82508306 |
| Molecular Formula | C11H18FN3 |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.15 |
| IUPAC Name | 2-(aminomethyl)-5-fluoro-4-N-methyl-4-N-propan-2-ylbenzene-1,4-diamine |
| SMILES | CC(C)N(C)c1cc(CN)c(N)cc1F |
| InChI | InChI=1S/C11H18FN3/c1-7(2)15(3)11-4-8(6-13)10(14)5-9(11)12/h4-5,7H,6,13-14H2,1-3H3 |
| InChIKey | LCHWKEUGYHWRCY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|