C10H17N3OS — CID 82509987
4-(2-piperazin-1-ylethyl)-1,4-thiazin-3-one (PubChem CID 82509987) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 4-(2-piperazin-1-ylethyl)-1,4-thiazin-3-one.
| Compound Name | 4-(2-piperazin-1-ylethyl)-1,4-thiazin-3-one |
|---|---|
| PubChem CID | 82509987 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-(2-piperazin-1-ylethyl)-1,4-thiazin-3-one |
| SMILES | O=C1CSC=CN1CCN1CCNCC1 |
| InChI | InChI=1S/C10H17N3OS/c14-10-9-15-8-7-13(10)6-5-12-3-1-11-2-4-12/h7-8,11H,1-6,9H2 |
| InChIKey | VOIJVZKIWWMCGH-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |