C11H15N5S — CID 82511741
1-[[5-(1,2,4-triazol-4-yl)thiophen-2-yl]methyl]piperazine (PubChem CID 82511741) has the molecular formula C11H15N5S and a molecular weight of 249.34 g/mol. Its IUPAC name is 1-[[5-(1,2,4-triazol-4-yl)thiophen-2-yl]methyl]piperazine.
| Compound Name | 1-[[5-(1,2,4-triazol-4-yl)thiophen-2-yl]methyl]piperazine |
|---|---|
| PubChem CID | 82511741 |
| Molecular Formula | C11H15N5S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1-[[5-(1,2,4-triazol-4-yl)thiophen-2-yl]methyl]piperazine |
| SMILES | c1cc(-n2cnnc2)sc1CN1CCNCC1 |
| InChI | InChI=1S/C11H15N5S/c1-2-11(16-8-13-14-9-16)17-10(1)7-15-5-3-12-4-6-15/h1-2,8-9,12H,3-7H2 |
| InChIKey | SFXJTCCKKITRAB-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |