3-imidazo[4,5-b]pyridin-3-yl-4-methoxybenzoic acid

C14H11N3O3 — CID 82514468

IUPAC3-imidazo[4,5-b]pyridin-3-yl-4-methoxybenzoic acid
SMILESCOc1ccc(C(=O)O)cc1-n1cnc2cccnc21
InChIInChI=1S/C14H11N3O3/c1-20-12-5-4-9(14(18)19)7-11(12)17-8-16-10-3-2-6-15-13(10)17/h2-8H,1H3,(H,18,19)
InChIKeyCVGQIRONYWVKBI-UHFFFAOYSA-N
MW269.26 g/mol
LogP2.13
Rot. Bonds3

About 3-imidazo[4,5-b]pyridin-3-yl-4-methoxybenzoic acid

3-imidazo[4,5-b]pyridin-3-yl-4-methoxybenzoic acid (PubChem CID 82514468) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is 3-imidazo[4,5-b]pyridin-3-yl-4-methoxybenzoic acid.

Molecular Properties

Compound Name3-imidazo[4,5-b]pyridin-3-yl-4-methoxybenzoic acid
PubChem CID82514468
Molecular FormulaC14H11N3O3
Molecular Weight269.26 g/mol
Exact Mass269.08
IUPAC Name3-imidazo[4,5-b]pyridin-3-yl-4-methoxybenzoic acid
SMILESCOc1ccc(C(=O)O)cc1-n1cnc2cccnc21
InChIInChI=1S/C14H11N3O3/c1-20-12-5-4-9(14(18)19)7-11(12)17-8-16-10-3-2-6-15-13(10)17/h2-8H,1H3,(H,18,19)
InChIKeyCVGQIRONYWVKBI-UHFFFAOYSA-N
XLogP2.13
TPSA77.24 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.26
LogP ≤ 52.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3-imidazo[4,5-b]pyridin-3-yl-4-methoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-imidazo[4,5-b]pyridin-3-yl-4-methoxybenzoic acid?
The IUPAC name of 3-imidazo[4,5-b]pyridin-3-yl-4-methoxybenzoic acid (CID 82514468) is 3-imidazo[4,5-b]pyridin-3-yl-4-methoxybenzoic acid.
What is the SMILES notation for 3-imidazo[4,5-b]pyridin-3-yl-4-methoxybenzoic acid?
The canonical SMILES for 3-imidazo[4,5-b]pyridin-3-yl-4-methoxybenzoic acid is COc1ccc(C(=O)O)cc1-n1cnc2cccnc21.
What is the InChIKey of 3-imidazo[4,5-b]pyridin-3-yl-4-methoxybenzoic acid?
The InChIKey is CVGQIRONYWVKBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O3/c1-20-12-5-4-9(14(18)19)7-11(12)17-8-16-10-3-2-6-15-13(10)17/h2-8H,1H3,(H,18,19).
What are the key properties of 3-imidazo[4,5-b]pyridin-3-yl-4-methoxybenzoic acid?
3-imidazo[4,5-b]pyridin-3-yl-4-methoxybenzoic acid has a molecular weight of 269.26 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazo[4,5-b]pyridin-3-yl-4-methoxybenzoic acid is sourced from PubChem (CID 82514468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).