C12H17N5S2 — CID 82515566
5-[2-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-4-yl]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 82515566) has the molecular formula C12H17N5S2 and a molecular weight of 295.44 g/mol. Its IUPAC name is 5-[2-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-4-yl]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[2-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-4-yl]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 82515566 |
| Molecular Formula | C12H17N5S2 |
| Molecular Weight | 295.44 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 5-[2-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-4-yl]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | CC1CCCCN1Cc1nc(-c2nc(=S)[nH][nH]2)cs1 |
| InChI | InChI=1S/C12H17N5S2/c1-8-4-2-3-5-17(8)6-10-13-9(7-19-10)11-14-12(18)16-15-11/h7-8H,2-6H2,1H3,(H2,14,15,16,18) |
| InChIKey | QDFSDOKOJBFMQN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|