C9H16N4OS — CID 82515623
2-(diethylaminomethyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 82515623) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-(diethylaminomethyl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-(diethylaminomethyl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 82515623 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-(diethylaminomethyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | CCN(CC)Cc1nc(C(=O)NN)cs1 |
| InChI | InChI=1S/C9H16N4OS/c1-3-13(4-2)5-8-11-7(6-15-8)9(14)12-10/h6H,3-5,10H2,1-2H3,(H,12,14) |
| InChIKey | FOVNATSQAPVQPE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|