C12H11ClN2O — CID 82519382
3-(aminomethyl)-6-(4-chlorophenyl)-1H-pyridin-2-one (PubChem CID 82519382) has the molecular formula C12H11ClN2O and a molecular weight of 234.69 g/mol. Its IUPAC name is 3-(aminomethyl)-6-(4-chlorophenyl)-1H-pyridin-2-one.
| Compound Name | 3-(aminomethyl)-6-(4-chlorophenyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 82519382 |
| Molecular Formula | C12H11ClN2O |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 3-(aminomethyl)-6-(4-chlorophenyl)-1H-pyridin-2-one |
| SMILES | NCc1ccc(-c2ccc(Cl)cc2)[nH]c1=O |
| InChI | InChI=1S/C12H11ClN2O/c13-10-4-1-8(2-5-10)11-6-3-9(7-14)12(16)15-11/h1-6H,7,14H2,(H,15,16) |
| InChIKey | YNMQDRHSJOAHCO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |