C12H15N5OS — CID 82521700
6-ethyl-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)-1,5,7,8-tetrahydro-1,6-naphthyridin-2-one (PubChem CID 82521700) has the molecular formula C12H15N5OS and a molecular weight of 277.35 g/mol. Its IUPAC name is 6-ethyl-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)-1,5,7,8-tetrahydro-1,6-naphthyridin-2-one.
| Compound Name | 6-ethyl-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)-1,5,7,8-tetrahydro-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 82521700 |
| Molecular Formula | C12H15N5OS |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 6-ethyl-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)-1,5,7,8-tetrahydro-1,6-naphthyridin-2-one |
| SMILES | CCN1CCc2[nH]c(=O)c(-c3nc(=S)[nH][nH]3)cc2C1 |
| InChI | InChI=1S/C12H15N5OS/c1-2-17-4-3-9-7(6-17)5-8(11(18)13-9)10-14-12(19)16-15-10/h5H,2-4,6H2,1H3,(H,13,18)(H2,14,15,16,19) |
| InChIKey | ZMFXOQYVZFMUHB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|