C10H13NO2 — CID 82526221
1-ethyl-4,6-dimethyl-2-oxopyridine-3-carbaldehyde (PubChem CID 82526221) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-ethyl-4,6-dimethyl-2-oxopyridine-3-carbaldehyde.
| Compound Name | 1-ethyl-4,6-dimethyl-2-oxopyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 82526221 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-ethyl-4,6-dimethyl-2-oxopyridine-3-carbaldehyde |
| SMILES | CCn1c(C)cc(C)c(C=O)c1=O |
| InChI | InChI=1S/C10H13NO2/c1-4-11-8(3)5-7(2)9(6-12)10(11)13/h5-6H,4H2,1-3H3 |
| InChIKey | RSUQPULMTSUWOQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|