C18H24N2O — CID 82526838
3-[amino-(3,4-dimethylphenyl)methyl]-1-butan-2-ylpyridin-2-one (PubChem CID 82526838) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 3-[amino-(3,4-dimethylphenyl)methyl]-1-butan-2-ylpyridin-2-one.
| Compound Name | 3-[amino-(3,4-dimethylphenyl)methyl]-1-butan-2-ylpyridin-2-one |
|---|---|
| PubChem CID | 82526838 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 3-[amino-(3,4-dimethylphenyl)methyl]-1-butan-2-ylpyridin-2-one |
| SMILES | CCC(C)n1cccc(C(N)c2ccc(C)c(C)c2)c1=O |
| InChI | InChI=1S/C18H24N2O/c1-5-14(4)20-10-6-7-16(18(20)21)17(19)15-9-8-12(2)13(3)11-15/h6-11,14,17H,5,19H2,1-4H3 |
| InChIKey | TWHFJXIQAXCFIR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |