C11H8ClFN2O2 — CID 82530686
(E)-3-(8-chloro-6-fluoro-2-methylimidazo[1,2-a]pyridin-3-yl)prop-2-enoic acid (PubChem CID 82530686) has the molecular formula C11H8ClFN2O2 and a molecular weight of 254.65 g/mol. Its IUPAC name is (E)-3-(8-chloro-6-fluoro-2-methylimidazo[1,2-a]pyridin-3-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(8-chloro-6-fluoro-2-methylimidazo[1,2-a]pyridin-3-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 82530686 |
| Molecular Formula | C11H8ClFN2O2 |
| Molecular Weight | 254.65 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | (E)-3-(8-chloro-6-fluoro-2-methylimidazo[1,2-a]pyridin-3-yl)prop-2-enoic acid |
| SMILES | Cc1nc2c(Cl)cc(F)cn2c1/C=C/C(=O)O |
| InChI | InChI=1S/C11H8ClFN2O2/c1-6-9(2-3-10(16)17)15-5-7(13)4-8(12)11(15)14-6/h2-5H,1H3,(H,16,17)/b3-2+ |
| InChIKey | HRJCXGFJQPEPLB-NSCUHMNNSA-N |
| XLogP | 2.53 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.65 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|