About 2-(butylamino)butyl 2-fluorobenzoate
2-(butylamino)butyl 2-fluorobenzoate (PubChem CID 82532208) has the molecular formula C15H22FNO2
and a molecular weight of 267.34 g/mol. Its IUPAC name is 2-(butylamino)butyl 2-fluorobenzoate.
Molecular Properties
| Compound Name | 2-(butylamino)butyl 2-fluorobenzoate |
| PubChem CID | 82532208 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-(butylamino)butyl 2-fluorobenzoate |
| SMILES | CCCCNC(CC)COC(=O)c1ccccc1F |
| InChI | InChI=1S/C15H22FNO2/c1-3-5-10-17-12(4-2)11-19-15(18)13-8-6-7-9-14(13)16/h6-9,12,17H,3-5,10-11H2,1-2H3 |
| InChIKey | ACUGFTDOPGXXIF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(butylamino)butyl 2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(butylamino)butyl 2-fluorobenzoate?
The IUPAC name of 2-(butylamino)butyl 2-fluorobenzoate (CID 82532208) is 2-(butylamino)butyl 2-fluorobenzoate.
What is the SMILES notation for 2-(butylamino)butyl 2-fluorobenzoate?
The canonical SMILES for 2-(butylamino)butyl 2-fluorobenzoate is CCCCNC(CC)COC(=O)c1ccccc1F.
What is the InChIKey of 2-(butylamino)butyl 2-fluorobenzoate?
The InChIKey is ACUGFTDOPGXXIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22FNO2/c1-3-5-10-17-12(4-2)11-19-15(18)13-8-6-7-9-14(13)16/h6-9,12,17H,3-5,10-11H2,1-2H3.
What are the key properties of 2-(butylamino)butyl 2-fluorobenzoate?
2-(butylamino)butyl 2-fluorobenzoate has a molecular weight of 267.34 g/mol, XLogP of 3.15, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butylamino)butyl 2-fluorobenzoate is sourced from PubChem (CID 82532208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).